k + h2o

and Terms and Conditions. How To Balance Equations. Please read my Disclaimer, Click here to contact Greg Thatcher  Input Equation Balanced Equation; K2O + P4O10 = K3PO4 : 6K2O + P4O10 = 4K3PO4: … ); The Gold Parsing System (Hats off! Copyright (c) 2013 Thatcher Development Software, LLC. Privacy Policy, Element 19 Kalium 鉀 Potassium K-38 Potassium K-43 Potassium K-40 Potassium K-42 Molar Mass of K Water - H 2 O Dihydrogen Monoxide Dihydridooxygen [OH2] HOH Hydrogen Hydroxide Dihydrogen Oxide Oxidane Hydrogen Oxide The Calitha - GOLD engine (c#) (Made it … The reaction releases heat and causes the potassium to burn with a purplish-colored flame. This program was created with a lot of help from: Genetic Algorithms Stock Portfolio Generator, Scan for all machines running IIS in a domain, Extract data from a Microsoft Word document. Problems, Comments, Suggestions? The reaction between potassium and water can be written as 2K + 2H2O -> 2KOH + H2… When potassium is added to water it creates hydrogen gas and a potassium hydroxide solution. For example, C6H5C2H5 + O2 = C6H5OH + CO2 + H2O will not be balanced, but XC2H5 + O2 = XOH + CO2 + H2O will. Compound states [like (s) (aq) or (g)] are not required. You can use parenthesis or brackets []. Read our article on how to … Click here to contact Greg Thatcher, 2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2, KMnO4 + NaNO2 + CH3COOH = (CH3COO)2Mn + NaNO3 + H2O + CH3COOK, 2KMnO4 + 5NaNO2 + 6CH3COOH = 2(CH3COO)2Mn + 5NaNO3 + 3H2O + 2CH3COOK, K2MnO4 +H2C2O4+ HCl = KCl + MnCl2 + CO2+ H2O, K2MnO4 + 2H2C2O4 + 4HCl = 2KCl + MnCl2 + 4CO2 + 4H2O, 2KMnO4 + 16HCl = 2MnCl2 + 2KCl + 5Cl2 + 8H2O, 2K2Cr2O7 + 3S + 2H2O = 3SO2 + 4KOH + 2Cr2O3, 6KI + 5H2SO3 = 3K2SO4 + 2H2S + 3I2 + 3H2O, KNO3 + H2SO4 + Hg = K2SO4 + HgSO4 + NO + H2O, 2KNO3 + 4H2SO4 + 3Hg = K2SO4 + 3HgSO4 + 2NO + 4H2O, K2Cr2O7 + 6 NaI + 7 H2SO4 = Cr2(SO4)3 + 3 I2 + 7 H2O + 3 Na2SO4 + K2SO4, K2Cr2O7 + 6NaI + 7H2SO4 = Cr2(SO4)3 + 3I2 + 7H2O + 3Na2SO4 + K2SO4, KMnO4 + Ag + HCl = MnCl2 + AgCl + H2O + KCl, KMnO4 + 5Ag + 8HCl = MnCl2 + 5AgCl + 4H2O + KCl, KMnO4 + H2C2O4 +HNO3=KNO3+CO2+Mn(NO3)2+H2O, 2KMnO4 + 5H2C2O4 + 6HNO3 = 2KNO3 + 10CO2 + 2Mn(NO3)2 + 8H2O, 2KMnO4 + 8HCl = 2KCl + 2MnO2 + 4H2O + 3Cl2, KMnO4 + FeSO4 + H2SO4 = K2SO4 + MnSO4 + Fe2(SO4)3 + H2O, 2KMnO4 + 10FeSO4 + 8H2SO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O, 20KI + 10H2SO4 = 10K2SO4 + 0SO2 + 20I + H20, K4Fe(CN)6 + KMnO4 + HCl = KCl + FeCl3 + MnCl2 + CO2 + NO + H2O, 5K4Fe(CN)6 + 43KMnO4 + 164HCl = 63KCl + 5FeCl3 + 43MnCl2 + 30CO2 + 30NO + 82H2O, K2SO4(aq) + CaCl2(aq) = CaSO4(s) + 2KCl(aq), KMnO4 (aq) + KI (aq) + H2SO4 (aq) = K2SO4 (aq)+ MnSO4 (s)+ I2 (g)+ H2O (l), 2KMnO4(aq) + 10KI(aq) + 8H2SO4(aq) = 6K2SO4(aq) + 2MnSO4(s) + 5I2(g) + 8H2O(l), 8KClO3 + C12H22O11 = 8KCl + 12CO2 + 11H2O, K2HPO4 + CO(NH2)2 = K2O + P2O5 + N2 + CO2 + H2O, 2K2HPO4 + 0CO(NH2)2 = 2K2O + P2O5 + 0N2 + 0CO2 + H2O, K2HPO4 + CO(NH2)2 = K2O + P2O5 + N2 + CO + H2O, 2K2HPO4 + 0CO(NH2)2 = 2K2O + P2O5 + 0N2 + 0CO + H2O, KH2PO4 + CO(NH2)2 = K2O + P2O5 + N2 + CO + 4H2O, 2KH2PO4 + 0CO(NH2)2 = K2O + P2O5 + 0N2 + 0CO + 2H2O, KH2PO4 + CO(NH2)2 = K2O + P2O5 + N2 + CO + H2O, 2KIO3 + 5SO2 + 4H2O = K2SO4 + I2 + 4H2SO4, 2KMnO4 + 16HCl = 5Cl2 + 2MnCl2 + 2KCl + 8H2O, K2Cr2O7 + HCl + NaNO2 = NaNO3 + CrCl3 + H2O + KCl, K2Cr2O7 + 8HCl + 3NaNO2 = 3NaNO3 + 2CrCl3 + 4H2O + 2KCl, K2SO4 (aq) + (NH4)3PO4 (aq) = KNH4 + (SO4)3(PO4)2, 3K2SO4(aq) + 2(NH4)3PO4(aq) = 6KNH4 + (SO4)3(PO4)2, K2Cr2O7 + HI + H2SO4 = K2SO4 + Cr2(SO4)3 + I2 + H2O, K2Cr2O7 + 6HI + 4H2SO4 = K2SO4 + Cr2(SO4)3 + 3I2 + 7H2O, -2KMnO4 + H2SO4 + 8KI = -2MnSO4 + 4I2 + 3K2SO + H2O, K2SO4 + C = K2S + CO, KMnO4 + 4HBr = MnBr2 + KBr + Br2 + 2H2O, 2KMnO4 + 16HBr = 2MnBr2 + 2KBr + 5Br2 + 8H2O, KCrO7 (aq) + 14HCl (aq) =CrCl3(aq) + 5Cl2(g) + KCl(aq) + 7H2O(l), KCrO7(aq) + 14HCl(aq) = CrCl3(aq) + 5Cl2(g) + KCl(aq) + 7H2O(l), KI + KMnO4 + H2SO4 = MnSO4+ K2SO4+ I2 + H2O, 10KI + 2KMnO4 + 8H2SO4 = 2MnSO4 + 6K2SO4 + 5I2 + 8H2O, KMnO4 + H2SO4 + H2C2O4 = CO2 + K2SO4 + MnSO4 + H2O, 2KMnO4 + 3H2SO4 + 5H2C2O4 = 10CO2 + K2SO4 + 2MnSO4 + 8H2O, KMnO7(s) + HBr(l) = MnBr2(s) + KBr(s) + Br2(g) + H2O(l), 2KMnO7(s) + 28HBr(l) = 2MnBr2(s) + 2KBr(s) + 11Br2(g) + 14H2O(l), K2SO4(aq) + CaI2(aq) = CaSO4(s) + 2KI(aq), 2KMnO4 + 5Hg2Cl2 + 16HCl = 10HgCl2 + 2MnCl2 + 2KCl + 8H2O, 2KMnO4 + 5SO2 + 2H2O = 2H2SO4 + 2MnSO4 + K2SO4, 2KMnO4 + 16HCl = 2MnCl2 + 2KCl + 8H2O + 5Cl2, KNO3(aq) + LiC2H3O2(aq) = KC2H3O2(aq) + LiNO3(aq), KMnO4 + (HO2C) 2 = CO2 + H2O + KMn (OH) 2, KMnO4 + 3(HO2C)2 = 6CO2 + 2H2O + KMn(OH)2, K2Cr2O7 + H2SO4 + KI = K2SO4 + Cr2(SO4)3 + H2O + I2, K2Cr2O7 + 7H2SO4 + 6KI = 4K2SO4 + Cr2(SO4)3 + 7H2O + 3I2, KMnO4 + K2SO3 + HCl = MnO2 + K2SO4 + KCl + H2O, 2KMnO4 + 3K2SO3 + 2HCl = 2MnO2 + 3K2SO4 + 2KCl + H2O, KMnO4 + CaC2O4 + H2SO4 = K2SO4 + MnSO4 + CaSO4 + CO2 + H2O, 2KMnO4 + 5CaC2O4 + 8H2SO4 = K2SO4 + 2MnSO4 + 5CaSO4 + 10CO2 + 8H2O, K2Cr2O7 + H202 + H2 SO4 = Cr2(SO4)3 + 02+ K2 SO4 + H20, 0K2Cr2O7 + 10H202 + 0H2SO4 = 0Cr2(SO4)3+02 + 0K2SO4 + 101H20, KI(aq) + Pb(NO3)2(aq) = PbI2(s) +KNO3(aq), 2KI(aq) + Pb(NO3)2(aq) = PbI2(s) + 2KNO3(aq), K3PO4(aq) + Ca(NO3)2(aq) = Ca3(PO4)2 (s)+ KNO3(aq), 2K3PO4(aq) + 3Ca(NO3)2(aq) = Ca3(PO4)2(s) + 6KNO3(aq), KCl(aq)+Se(s)+I2(s)+H2O(l)=K2SeO3(aq)+KI(aq)+HCl(aq), 6KCl(aq) + Se(s) + 2I2(s) + 3H2O(l) = K2SeO3(aq) + 4KI(aq) + 6HCl(aq), K2C2O4 (l) + Ba(NO3)2 (l) = BaC2O4 + KNO3, K2C2O4 (l) + Ca(NO3)2 (l) = KNO3 + CaC2O4, KOH(aq) + H3PO4(aq) = K3PO4(aq) + H2O(l), 3KOH(aq) + H3PO4(aq) = K3PO4(aq) + 3H2O(l), KIO3 + KI + HNO3 = KNO3 + I2 + H2O, KIO3 + KI + H2SO4 = K2SO4 + I2 + H2O, KIO3 + 5KI + 3H2SO4 = 3K2SO4 + 3I2 + 3H2O, KClO3+Cr2(SO4)3+KOH=KCl +K2SO4+K2CrO4+H2O, KClO3 + Cr2(SO4)3 + 10KOH = KCl + 3K2SO4 + 2K2CrO4 + 5H2O, K2Cr2O7+H2SO4+ FeSO4 = Cr2(SO4)3+ H2O + Fe2(SO4)3 + K2SO4, K2Cr2O7 + 7H2SO4 + 6FeSO4 = Cr2(SO4)3 + 7H2O + 3Fe2(SO4)3 + K2SO4, 3KNO2 + K2Cr2O7 + 8HNO3 = 5KNO3 + 2Cr(NO3)3 + 4H2O, KMnO4+FeSO4+H2SO4=K2SO4+Fe2(SO4)3+MnSO4+H2O, 2KMnO4 + 10FeSO4 + 8H2SO4 = K2SO4 + 5Fe2(SO4)3 + 2MnSO4 + 8H2O, KMnO4+FeSO4+H2SO4=K2SO4+Fe(SO4)3+MnSO4+H2O, 4KMnO4 + 5FeSO4 + 16H2SO4 = 2K2SO4 + 5Fe(SO4)3 + 4MnSO4 + 16H2O, 2KMnO4 + 3KNO2 + H2O = 2MnO2 + 3KNO3 + 2KOH, KBr (s) + N2 (g) = K3N (s) + Br2 (l), KMnO4 + LiCl + H2SO4 = Cl2 + MnSO4 + K2SO4 + Li2SO4 + H20, 0KMnO4 + 20LiCl + 10H2SO4 = 10Cl2 + 0MnSO4 + 0K2SO4 + 10Li2SO4 + H20, 2KOH(aq) + H2SO4(aq) = K2SO4(aq) + 2H2O(l), K3PO4(aq) + Cr(C2H3O2)3(aq) =CrPO4(s) + 3 KC2H3O2(aq), K3PO4(aq) + Cr(C2H3O2)3(aq) = CrPO4(s) + 3KC2H3O2(aq), 2KBr + 2NaNO2 + 4HCl = Br2 + 2NO + 2H2O + 2KCl + 2NaCl, KOH(aq)+(NH4)2SO4(aq)= K2SO4(aq)+NH3(g)+H2O(l)=, 2KOH(aq) + (NH4)2SO4(aq) = K2SO4(aq) + 2NH3(g) + 2H2O(l), KMnO4 + LiCl + H2SO4 = Cl2 + MnSO4 + K2SO4 + Li2SO4 + H2O, 2KMnO4 + 10LiCl + 8H2SO4 = 5Cl2 + 2MnSO4 + K2SO4 + 5Li2SO4 + 8H2O, K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 +H2O + KCl, K2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 7H2O + 2KCl, KBrO3 + KI + H2SO4 = KBr + I2 + K2SO4 + H2O, KBrO3 + 6KI + 3H2SO4 = KBr + 3I2 + 3K2SO4 + 3H2O, K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2O, K2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O, K2CO3 + AlCl3 = Al2(CO3)3 + KCl, KMnO4 + H2SO4 + KI = MnSO4 + H2O + I2 + K2SO4, 2KMnO4 + 8H2SO4 + 10KI = 2MnSO4 + 8H2O + 5I2 + 6K2SO4, KMnO4 + 8HCL + 6KI = MnCL + 3I2 + 7KCL + 4H2O, K2SO4(aq) + BaCl2(aq) = BaSO4(s) + KCl(aq), K2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2KCl(aq), 2KMnO4 + 16HCl = 2MnCl2 + 5Cl2 + 8H2O + 2KCl, K2SO4(aq) + 2NaNO3(aq) = 2KNO3(s) + Na2SO4(aq), K3PO4(aq) + Pb(NO3)2(aq)=KNO3(s)+Pb3(PO4)2(aq), 2K3PO4(aq) + 3Pb(NO3)2(aq) = 6KNO3(s) + Pb3(PO4)2(aq), K4Fe(CN)6 + KMnO4 +HCl=KCl + FeCl3 + MnCl2 + CO2 +NO +H2O, KOH(aq) + NiCl2(aq) =Ni(OH)2(s) + KCl(aq), 2KOH(aq) + NiCl2(aq) = Ni(OH)2(s) + 2KCl(aq), K2Cr2O7 + KCl + H2SO4 = Cr2(SO4)3 + Cl2 + H2O + K2SO4, K2Cr2O7 + 6KCl + 7H2SO4 = Cr2(SO4)3 + 3Cl2 + 7H2O + 4K2SO4, KOH(aq) + (NH4)3PO4(aq) = K3PO4(s) + NH3(g) + H2O(l), 3KOH(aq) + (NH4)3PO4(aq) = K3PO4(s) + 3NH3(g) + 3H2O(l), K2SO4(aq) + BaCl2(aq) = 2KCl(aq) + BaSO4(s), K2Cr2O7 +H2SO4 +H2C2O4=Cr2(S04)3 + H2O+ CO2 + K2SO4, K2Cr2O7 + 13H2SO4 + 42H2C2O4 = Cr2(S04)3 + 55H2O + 84CO2 + K2SO4, K2Cr2O7 + 3HCO2 + H2SO4 = Cr2(SO4)3 + K2SO4 + CO2 + H2O, K2Cr2O7 + 6HCO2 + 4H2SO4 = Cr2(SO4)3 + K2SO4 + 6CO2 + 7H2O, K2Cr2O7 + H2SO4 + C2H6O = K2SO4 + Cr2(SO4)3 + C2H4O2 + H2O, 2K2Cr2O7 + 8H2SO4 + 3C2H6O = 2K2SO4 + 2Cr2(SO4)3 + 3C2H4O2 + 11H2O, K2CrO7 + H2SO4 + C2H6O = K2SO4 + Cr2(SO4)3 + C2H4O2 + H2O, 4K2CrO7 + 10H2SO4 + 9C2H6O = 4K2SO4 + 2Cr2(SO4)3 + 9C2H4O2 + 19H2O, KMnO4 + C6H12O6 = CO2 + H2O + K2CO3 + MnO, 24KMnO4 + 5C6H12O6 = 18CO2 + 30H2O + 12K2CO3 + 24MnO, KMn O4 + K 2 C 2 O4 + H 2 S O4 = MnS O4 + K2 S O4 + C O2 + H2O, 2KMnO4 + 5K2C2O4 + 8H2SO4 = 2MnSO4 + 6K2SO4 + 10CO2 + 8H2O, KOH(aq) + Cu(NO3)2(aq) = Cu(OH)2(s) + KNO3(aq), 2KOH(aq) + Cu(NO3)2(aq) = Cu(OH)2(s) + 2KNO3(aq), KMnO4 + HCl + Na2S2O3 = KCl + MnCl2 + H2O + NaSO4, 2KMnO4 + 6HCl + Na2S2O3 = 2KCl + 2MnCl2 + 3H2O + 2NaSO4, KMnO4 + HCl + Na2S2O3 = MnCl2 + H2O + KOH + NaSO4, 2KMnO4 + 4HCl + Na2S2O3 = 2MnCl2 + H2O + 2KOH + 2NaSO4, 2KMn04 - 17Na2SO3 + H2O = 8MnO2 - 17Na2SO4 + 2KOH, KI(aq) + Fe(NO3)3(aq) = Fe(NO3)2(aq) + KNO3(aq) + I2(aq), 2KI(aq) + 2Fe(NO3)3(aq) = 2Fe(NO3)2(aq) + 2KNO3(aq) + I2(aq), KMnO4 + CaC2O4 + H2SO4 = MnSO4 + K2SO4 + CaSO4 + CO2 + H2O, 2KMnO4 + 5CaC2O4 + 8H2SO4 = 2MnSO4 + K2SO4 + 5CaSO4 + 10CO2 + 8H2O, K2SO4(aq) + BaCl2(aq) =BaSO4(s) + KCl(aq), K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq), 6K3Fe(CN)6 + Cr2O3 + 10KOH = 6K4Fe(CN)6 + 2K2CrO4 + 5H2O, KMnO4 + FeBr3 + H2SO4 = MnSO4 + K2SO4 + Fe2(SO4)3 + Br2 + H2O, 6KMnO4 + 10FeBr3 + 24H2SO4 = 6MnSO4 + 3K2SO4 + 5Fe2(SO4)3 + 15Br2 + 24H2O, K2Cr2O7(s) + K2CO3(aq) = K2CrO4(aq) + CO2(g), K2Cr2O7(s) + K2CO3(aq) = 2K2CrO4(aq) + CO2(g), K2Cr2O7 + FeSO4 + H2SO4 = Cr2(SO4)3 + Fe2(SO4)3 + K2SO4 + H2O, K2Cr2O7 + 6FeSO4 + 7H2SO4 = Cr2(SO4)3 + 3Fe2(SO4)3 + K2SO4 + 7H2O, K2Cr2O7+FeSO4+H2SO4 = Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O, KMnO4 + KI + HCl = I2 + MnCl2 + H2O + KCl, 2KMnO4 + 10KI + 16HCl = 5I2 + 2MnCl2 + 8H2O + 12KCl, KMnO4 + H2SO4 + KNO2 = K2SO4 + MnSO4 + H2O + KNO3, 2KMnO4 + 3H2SO4 + 5KNO2 = K2SO4 + 2MnSO4 + 3H2O + 5KNO3, K2Cr2O7 + KI + H2SO4 = Cr2(SO4)3 + K2SO4 + I2 + H2O, K2Cr2O7 + 6KI + 7H2SO4 = Cr2(SO4)3 + 4K2SO4 + 3I2 + 7H2O, K2Cr2O7 + H2S + HCl =CrCl3 + S + KCl + H2O, K2Cr2O7 + 3H2S + 8HCl = 2CrCl3 + 3S + 2KCl + 7H2O, K2Cr2O7 + 3SnCl2 + 14HCl = 3SnCl4 + 2CrCl3 + 7H2O + 2KCl, KO2 (s)+ H2O(g)+ CO2 (g)= KHCO3 (s)+ O2 (g), 4KO2(s) + 2H2O(g) + 4CO2(g) = 4KHCO3(s) + 3O2(g), KMnO4 + H2SO4 + CH3CH2OH = MnSO4 + CH3COOH + K2SO4 + H2O, 4KMnO4 + 6H2SO4 + 5CH3CH2OH = 4MnSO4 + 5CH3COOH + 2K2SO4 + 11H2O, KIO3 + 5KI + 3H2SO4 = 3K2SO4 + 3H2O + 3I2, KIO3 + 5 KI + 3 H2SO4 = 3 K2SO4 + 3 H2O + 3 I2, Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O.

History Of Lifestyle Diseases, Adidas Tennis Shoes, In A Pressurized Water Reactor Mcq, Jack Kelly Lawyer Hands, Black Dog Haltermate, Global Hyatt Owner, Air Bike Workout, Data Handling For Year 1,

Leave a Reply

Your email address will not be published. Required fields are marked *